5,10,15,20-Tetra(4-sulfonatophenyl)porphyrin-Fe(III) chloride acid form

101,00 580,00 

Catalog No.: FeT1239

50mg, 100mg. 250mg. 1g

CAS No.: 90384-82-0, MDL: MFCD00216780, Molecular weight: 1024.26 g/mol, Molecular Formula: C44H28ClFeN4O12S4,
Purity: 98%

Smile Code: OS(=O)(=O)C1=CC=C(C=C1)C1=C2\C=C/C3=C(/C4=N/C(/C=C4)=C(\C4=CC=C(N4[Fe](Cl)N2\3)\C(=C2\C=CC\1=N2)C1=CC=C(C=C1)S(O)(=O)=O)C1=CC=C(C=C1)S(O)(=O)=O)C1=CC=C(C=C1)S(O)(=O)=O

Alternative Names: Fe(III) meso-Tetra(4-sulfonatophenyl)porphine chloride (acid form) 5,10,15,20-Tetrakis(4-sulfonatophenyl)-21H,23H-porphine iron(III) chloride

Producer: Frontier Specialty Chemicals

gram

0,05, 0,1, 0,25, 1

Shopping Cart