Octaethylporphyrin

60,00 1.100,00 

Catalog No.: O534

100mg, 250mg, 1g, 5g, 10g

CAS No.: 2683-82-1, MDL No.: MFCD00009627, Molecular Formula: C36H46N4, Molecular weight: 534.78, Purity: 97%
Smile Code: CCC1=C(CC)C2=NC1=CC3=C(CC)C(CC)=C(N3)C=C4C(CC)=C(CC)C(C=C5C(CC)=C(CC)C(N5)=C2)=N4

Precautionary Statements: P261-P280-P301+P312-P302+P352-P305+P351+P338
Hazard Statements: H302-H315-H319-H335

Alternative Names: Octaethylporphine chloride

gram

0,1, 0,25, 0,5, 1, 5, 10

Shopping Cart