Octaethylporphyrin-Fe(III) chloride

234,00 1.845,00 

Catalog No.: O40944

100mg, 250mg, 500mg, 1g, 5g

CAS No.: 28755-93-3, MDL No.: MFCD00011614, Molecular Formula: C36H44ClFeN4, Molecular Weight: 624.06, Purity: 98%

Smile Code: CCC1=C(CC)C2=N\C\1=C/C1=C(CC)C(CC)=C3\C=C4/N=C(/C=C5\N([Fe](Cl)N13)/C(=C\2)C(CC)=C5CC)C(CC)=C4CC

Alternatives Names: Fe(III) Octaethylporphine chloride

Producer: Porphyrin Systems, Frontier, Specialty Chemicals

gram

0,1, 0,25, 1, 5

Shopping Cart