Fe(III) Deuteroporphyrin IX chloride

280,00 365,00 

Catalog No.: D40654


CAS No.: 21007-21-6, MDL No.: MFCD18070953, Molecular Formula.: C30H28ClFeN4O4, Molecular Weight: 599.87, 98%

Smile Code: O=C(CCC1=C(C)C2=CC3=CC(C)=C4C=C5C=C(C)C6=[N]5[Fe+3]([Cl-])([N-]34)([N-]78)[N]2=C1C=C8C(CCC([O-])=O)=C(C)C7=C6)[O-].[H+].[H+]

Alternative Names: Fe(III) Deuteroporphyrin IX chloride Deutero-hemin

Produced by Frontier Specialty Chemicals


0,005, 0,01, 0,025, 0,05, 0,1, 0,25, 2,5, 0,5, 1, 5, 10, 25, 50, 100

Shopping Cart