Deuteroporphyrin IX 2,4-disulfonic acid dimethyl ester disodium salt

185,00 410,00 

Catalog No.: D696-9

Clear

CAS Number: 58537-78-3, Molecular Formula: C32H32N4O10S2Na2, Formula Weight:: 742.73, Purity. 98%

SMILES: CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)S(=O)(=O)[O-])C)C(=C4CCC(=O)OC)C)C(=C3C)CCC(=O)OC)S(=O)(=O)[O-].[Na+].[Na+]

Produced by Frontier Specialty Chemicals

gram

0,005, 0,01, 0,025, 0,05, 0,1, 0,25, 2,5, 0,5, 1, 5, 10, 25, 50, 100

Shopping Cart