5,10,15,20-Tetra(4-sulfonatophenyl)porphyrin-Mn(III) chloride

190,00 360,00 

Catalog No.: MnT1239

Clear

CAS No.: 221176-50-7, MDL No.: MFCD00216662, Molecular Formula: C44H28ClMnN4O12S4, Molecular Weight: 1023.36, Purity: 98%

Smile Code: OS(=O)(=O)C1=CC=C(C=C1)C1=C2\C=C/C3=C(/C4=N/C(/C=C4)=C(\C4=CC=C(N4[Mn](Cl)N2\3)\C(=C2\C=CC\1=N2)C1=CC=C(C=C1)S(O)(=O)=O)C1=CC=C(C=C1)S(O)(=O)=O)C1=CC=C(C=C1)S(O)(=O)=O

Alternative Names: Mn(III) meso-Tetra(4-sulfonatophenyl)porphine chloride

Producer: Frontier Specialy Chemicals

gram

0,025, 0,05, 0,1, 0,25, 2,5, 0,5, 1, 5, 10, 25, 50, 100

Shopping Cart